C22H43NO8Si — CID 10624465
tert-butyl (4S,5S)-4-[(R)-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxyoxolan-2-yl]-hydroxymethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10624465) has the molecular formula C22H43NO8Si and a molecular weight of 477.67 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[(R)-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxyoxolan-2-yl]-hydroxymethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[(R)-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxyoxolan-2-yl]-hydroxymethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10624465 |
| Molecular Formula | C22H43NO8Si |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | tert-butyl (4S,5S)-4-[(R)-[(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxyoxolan-2-yl]-hydroxymethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1[C@@H](O)[C@@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C22H43NO8Si/c1-12-13(23(22(8,9)29-12)19(27)30-20(2,3)4)14(24)16-15(25)17(18(26)28-16)31-32(10,11)21(5,6)7/h12-18,24-26H,1-11H3/t12-,13+,14+,15-,16-,17+,18?/m0/s1 |
| InChIKey | SYAIELNDEZZXTI-SLXQCEAQSA-N |
| XLogP | 2.58 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|