C22H43NO6Si — CID 53392642
tert-butyl (3aS,4R,6aR)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 53392642) has the molecular formula C22H43NO6Si and a molecular weight of 445.67 g/mol. Its IUPAC name is tert-butyl (3aS,4R,6aR)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4R,6aR)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 53392642 |
| Molecular Formula | C22H43NO6Si |
| Molecular Weight | 445.67 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | tert-butyl (3aS,4R,6aR)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2OC(C)(C)O[C@H]2[C@@H]1[C@@H](CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43NO6Si/c1-20(2,3)28-19(25)23-14-16-18(27-22(7,8)26-16)17(23)15(12-11-13-24)29-30(9,10)21(4,5)6/h15-18,24H,11-14H2,1-10H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | VLLDTEMXMHJMEZ-ZJPYXAASSA-N |
| XLogP | 4.29 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|