C21H38FNO7Si — CID 71819334
tert-butyl (3aS,5R,6R,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(fluoromethyl)-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 71819334) has the molecular formula C21H38FNO7Si and a molecular weight of 463.62 g/mol. Its IUPAC name is tert-butyl (3aS,5R,6R,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(fluoromethyl)-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,5R,6R,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(fluoromethyl)-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 71819334 |
| Molecular Formula | C21H38FNO7Si |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl (3aS,5R,6R,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(fluoromethyl)-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CF)[C@@H](OC=O)[C@@H]2OC(C)(C)O[C@@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38FNO7Si/c1-18(2,3)29-17(25)23-14(11-22)15(26-13-24)16-21(23,30-20(7,8)28-16)12-27-31(9,10)19(4,5)6/h13-16H,11-12H2,1-10H3/t14-,15+,16-,21-/m0/s1 |
| InChIKey | ZZFXXKYEWJJWTB-YJXLLHPSSA-N |
| XLogP | 3.99 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|