C20H37NO7Si — CID 71819197
tert-butyl (3aR,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 71819197) has the molecular formula C20H37NO7Si and a molecular weight of 431.60 g/mol. Its IUPAC name is tert-butyl (3aR,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aR,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 71819197 |
| Molecular Formula | C20H37NO7Si |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl (3aR,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](OC=O)[C@H]2OC(C)(C)O[C@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37NO7Si/c1-17(2,3)27-16(23)21-11-14(24-13-22)15-20(21,28-19(7,8)26-15)12-25-29(9,10)18(4,5)6/h13-15H,11-12H2,1-10H3/t14-,15-,20-/m1/s1 |
| InChIKey | SZSYXOBGGJRGHV-STXHMFSFSA-N |
| XLogP | 3.65 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|