C17H32FNO4Si — CID 72567278
tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 72567278) has the molecular formula C17H32FNO4Si and a molecular weight of 361.53 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 72567278 |
| Molecular Formula | C17H32FNO4Si |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)C2OCC(O[Si](C)(C)C(C)(C)C)C21 |
| InChI | InChI=1S/C17H32FNO4Si/c1-16(2,3)22-15(20)19-9-11(18)14-13(19)12(10-21-14)23-24(7,8)17(4,5)6/h11-14H,9-10H2,1-8H3 |
| InChIKey | MJLKJCNTBFXQQW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|