C16H29NO7 — CID 10948008
tert-butyl (3aR,4S,6aS)-2,2-dimethyl-4-[(2S,3S)-2,3,4-trihydroxybutyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 10948008) has the molecular formula C16H29NO7 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6aS)-2,2-dimethyl-4-[(2S,3S)-2,3,4-trihydroxybutyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6aS)-2,2-dimethyl-4-[(2S,3S)-2,3,4-trihydroxybutyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 10948008 |
| Molecular Formula | C16H29NO7 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl (3aR,4S,6aS)-2,2-dimethyl-4-[(2S,3S)-2,3,4-trihydroxybutyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C16H29NO7/c1-15(2,3)24-14(21)17-7-12-13(23-16(4,5)22-12)9(17)6-10(19)11(20)8-18/h9-13,18-20H,6-8H2,1-5H3/t9-,10-,11-,12-,13+/m0/s1 |
| InChIKey | BLHWDZIZSXMHAS-PJSNJIKXSA-N |
| XLogP | 0.23 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |