C16H31NO8 — CID 134931217
tert-butyl (4R)-2,2-dimethyl-4-[(1R,2S,3S)-1,2,3-trihydroxy-4,4-dimethoxybutyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 134931217) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(1R,2S,3S)-1,2,3-trihydroxy-4,4-dimethoxybutyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(1R,2S,3S)-1,2,3-trihydroxy-4,4-dimethoxybutyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134931217 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(1R,2S,3S)-1,2,3-trihydroxy-4,4-dimethoxybutyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(OC)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO8/c1-15(2,3)25-14(21)17-9(8-24-16(17,4)5)10(18)11(19)12(20)13(22-6)23-7/h9-13,18-20H,8H2,1-7H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | MEXBNNUBOJEKPG-WYUUTHIRSA-N |
| XLogP | 0.06 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|