C13H23NO7 — CID 118520791
tert-butyl N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate (PubChem CID 118520791) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118520791 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | tert-butyl N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1[C@@H]2OC[C@](CO)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO7/c1-12(2,3)21-11(18)14(4)7-8(16)9(17)13(5-15)6-19-10(7)20-13/h7-10,15-17H,5-6H2,1-4H3/t7-,8-,9-,10-,13+/m1/s1 |
| InChIKey | LGLYGISPBZZYBP-ACDNLYMZSA-N |
| XLogP | -0.94 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |