C13H26O5 — CID 158061142
methane;(1S,2R,3R,4R,5S)-4-methyl-1-[(2-methylpropan-2-yl)oxymethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 158061142) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is methane;(1S,2R,3R,4R,5S)-4-methyl-1-[(2-methylpropan-2-yl)oxymethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | methane;(1S,2R,3R,4R,5S)-4-methyl-1-[(2-methylpropan-2-yl)oxymethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 158061142 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | methane;(1S,2R,3R,4R,5S)-4-methyl-1-[(2-methylpropan-2-yl)oxymethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | C.C[C@H]1[C@H]2OC[C@](COC(C)(C)C)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22O5.CH4/c1-7-8(13)9(14)12(5-15-10(7)17-12)6-16-11(2,3)4;/h7-10,13-14H,5-6H2,1-4H3;1H4/t7-,8-,9-,10+,12-;/m1./s1 |
| InChIKey | FKQSEFOAAFSHAO-IMOBDCPJSA-N |
| XLogP | 0.92 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |