C10H16O6 — CID 152993725
1-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]propan-2-one (PubChem CID 152993725) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]propan-2-one.
| Compound Name | 1-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 152993725 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1[C@H]2OC[C@](CO)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O6/c1-5(12)2-6-7(13)8(14)10(3-11)4-15-9(6)16-10/h6-9,11,13-14H,2-4H2,1H3/t6-,7-,8-,9+,10+/m1/s1 |
| InChIKey | UWUGBTOGMZKGSL-VFCFLDTKSA-N |
| XLogP | -1.58 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |