C7H12O6 — CID 51003894
(1R,2R,3R,4S,5R)-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 51003894) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R)-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2R,3R,4S,5R)-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 51003894 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1R,2R,3R,4S,5R)-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | OC[C@]12CO[C@H](O1)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C7H12O6/c8-1-7-2-12-6(13-7)4(10)3(9)5(7)11/h3-6,8-11H,1-2H2/t3-,4-,5+,6+,7+/m0/s1 |
| InChIKey | UQLOKDSDWXQUBM-PAMBMQIZSA-N |
| XLogP | -2.81 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |