C9H15NO5S — CID 123215610
N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(sulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 123215610) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(sulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(sulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 123215610 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(sulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](CS)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H15NO5S/c1-4(11)10-5-6(12)7(13)9(3-16)2-14-8(5)15-9/h5-8,12-13,16H,2-3H2,1H3,(H,10,11)/t5-,6-,7-,8+,9-/m1/s1 |
| InChIKey | BMJBKBSMUYGILS-GOFVFXDOSA-N |
| XLogP | -1.73 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|