C19H35NO10S — CID 155274350
N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-[2-[2-[2-[2-(1-hydroxyethylsulfanyl)ethoxy]ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 155274350) has the molecular formula C19H35NO10S and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-[2-[2-[2-[2-(1-hydroxyethylsulfanyl)ethoxy]ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-[2-[2-[2-[2-(1-hydroxyethylsulfanyl)ethoxy]ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 155274350 |
| Molecular Formula | C19H35NO10S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-[2-[2-[2-[2-(1-hydroxyethylsulfanyl)ethoxy]ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COCCOCCOCCOCCSC(C)O)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H35NO10S/c1-13(21)20-15-16(23)17(24)19(12-29-18(15)30-19)11-28-8-7-26-4-3-25-5-6-27-9-10-31-14(2)22/h14-18,22-24H,3-12H2,1-2H3,(H,20,21)/t14?,15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | IJPIXDDZKHOEQA-LGPGXAGSSA-N |
| XLogP | -1.52 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|