C21H37NO12S — CID 118510852
2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 118510852) has the molecular formula C21H37NO12S and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118510852 |
| Molecular Formula | C21H37NO12S |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COCCOCCOCCOCCOS(C)(=O)=O)(O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H37NO12S/c1-15(23)22-16-17-18(33-20(2,3)32-17)21(14-30-19(16)34-21)13-29-10-9-27-6-5-26-7-8-28-11-12-31-35(4,24)25/h16-19H,5-14H2,1-4H3,(H,22,23)/t16-,17-,18-,19+,21+/m1/s1 |
| InChIKey | DRCUNLPIVQXZOP-TYZHSBRISA-N |
| XLogP | -0.82 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|