C22H37NO10S — CID 118510989
S-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate (PubChem CID 118510989) has the molecular formula C22H37NO10S and a molecular weight of 507.60 g/mol. Its IUPAC name is S-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate.
| Compound Name | S-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 118510989 |
| Molecular Formula | C22H37NO10S |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | S-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COCCOCCOCCOCCSC(C)=O)(O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C22H37NO10S/c1-15(24)23-17-18-19(32-21(3,4)31-18)22(14-30-20(17)33-22)13-29-10-9-27-6-5-26-7-8-28-11-12-34-16(2)25/h17-20H,5-14H2,1-4H3,(H,23,24)/t17-,18-,19-,20+,22+/m1/s1 |
| InChIKey | XIVBYKFUHXAOAN-YHZBMZHBSA-N |
| XLogP | 0.48 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|