C22H39NO11S — CID 129015260
2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 129015260) has the molecular formula C22H39NO11S and a molecular weight of 525.62 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 129015260 |
| Molecular Formula | C22H39NO11S |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(=O)N[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@]2(COCCOCCOCCOCCOS(C)(=O)=O)CC[C@H]1O2 |
| InChI | InChI=1S/C22H39NO11S/c1-16(24)23-18-17-5-6-22(32-17,20-19(18)33-21(2,3)34-20)15-30-12-11-28-8-7-27-9-10-29-13-14-31-35(4,25)26/h17-20H,5-15H2,1-4H3,(H,23,24)/t17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | PTWVAPHRYDDHDQ-AIYVTKCESA-N |
| XLogP | -0.01 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|