C24H43NO10 — CID 129132525
tert-butyl N-[(1S,2R,6R,7R,8S)-4,4-dimethyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate (PubChem CID 129132525) has the molecular formula C24H43NO10 and a molecular weight of 505.61 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,6R,7R,8S)-4,4-dimethyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R,6R,7R,8S)-4,4-dimethyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate |
|---|---|
| PubChem CID | 129132525 |
| Molecular Formula | C24H43NO10 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | tert-butyl N-[(1S,2R,6R,7R,8S)-4,4-dimethyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate |
| SMILES | CCCOCCOCCOCCOC[C@@]12CO[C@@H](O1)[C@H](NC(=O)OC(C)(C)C)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H43NO10/c1-7-8-27-9-10-28-11-12-29-13-14-30-15-24-16-31-20(34-24)17(25-21(26)35-22(2,3)4)18-19(24)33-23(5,6)32-18/h17-20H,7-16H2,1-6H3,(H,25,26)/t17-,18-,19-,20+,24+/m1/s1 |
| InChIKey | AKKJXWMYZWJMQO-WRVPFMQZSA-N |
| XLogP | 2.00 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|