C19H32N2O8 — CID 166975558
4-[[(2R,6R,7R)-4,4-dimethyl-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]amino]butanoic acid (PubChem CID 166975558) has the molecular formula C19H32N2O8 and a molecular weight of 416.47 g/mol. Its IUPAC name is 4-[[(2R,6R,7R)-4,4-dimethyl-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]amino]butanoic acid.
| Compound Name | 4-[[(2R,6R,7R)-4,4-dimethyl-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 166975558 |
| Molecular Formula | C19H32N2O8 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-[[(2R,6R,7R)-4,4-dimethyl-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]amino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCC12COC(O1)[C@H](NCCCC(=O)O)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H32N2O8/c1-17(2,3)29-16(24)21-9-19-10-25-15(28-19)12(20-8-6-7-11(22)23)13-14(19)27-18(4,5)26-13/h12-15,20H,6-10H2,1-5H3,(H,21,24)(H,22,23)/t12-,13-,14-,15?,19?/m1/s1 |
| InChIKey | SEUAWMKISUDCET-WCLOGPDFSA-N |
| XLogP | 0.98 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|