C20H28N2O7 — CID 174154666
tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(4-oxo-1-pyridinyl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate (PubChem CID 174154666) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(4-oxo-1-pyridinyl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(4-oxo-1-pyridinyl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154666 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(4-oxo-1-pyridinyl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@]12COC(n3ccc(=O)cc3)(CO1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H28N2O7/c1-17(2,3)29-16(24)21-10-19-11-26-20(12-25-19,22-8-6-13(23)7-9-22)15-14(19)27-18(4,5)28-15/h6-9,14-15H,10-12H2,1-5H3,(H,21,24)/t14-,15+,19+,20?/m1/s1 |
| InChIKey | PPVAVOOWCKDTRC-BQRQEFCASA-N |
| XLogP | 1.35 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |