C18H28N2O7 — CID 174154676
tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-oxoazetidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate (PubChem CID 174154676) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-oxoazetidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-oxoazetidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154676 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-oxoazetidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@]12COC(N3CCC3=O)(CO1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H28N2O7/c1-15(2,3)27-14(22)19-8-17-9-24-18(10-23-17,20-7-6-11(20)21)13-12(17)25-16(4,5)26-13/h12-13H,6-10H2,1-5H3,(H,19,22)/t12-,13+,17+,18?/m1/s1 |
| InChIKey | XCSGHZGCPGSTBK-XQTYQYSGSA-N |
| XLogP | 0.76 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |