C18H29N3O6S — CID 174154644
tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-sulfanylideneimidazolidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate (PubChem CID 174154644) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-sulfanylideneimidazolidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-sulfanylideneimidazolidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154644 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | tert-butyl N-[[(1S,2R,6S)-4,4-dimethyl-7-(2-sulfanylideneimidazolidin-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@]12COC(N3CCNC3=S)(CO1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H29N3O6S/c1-15(2,3)27-14(22)20-8-17-9-24-18(10-23-17,21-7-6-19-13(21)28)12-11(17)25-16(4,5)26-12/h11-12H,6-10H2,1-5H3,(H,19,28)(H,20,22)/t11-,12+,17+,18?/m1/s1 |
| InChIKey | RQQGLERLGDWSDA-VICYJQCKSA-N |
| XLogP | 0.72 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|