C15H26N2O5 — CID 11500621
tert-butyl N-[3-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]propyl]carbamate (PubChem CID 11500621) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 11500621 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | tert-butyl N-[3-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H]1NC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H26N2O5/c1-14(2,3)22-13(19)16-8-6-7-9-10-11(12(18)17-9)21-15(4,5)20-10/h9-11H,6-8H2,1-5H3,(H,16,19)(H,17,18)/t9-,10+,11+/m0/s1 |
| InChIKey | SMTMGKUYJOTVLL-HBNTYKKESA-N |
| XLogP | 1.31 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|