C14H19FN2O5 — CID 168784593
tert-butyl N-[4-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-4-oxobutyl]carbamate (PubChem CID 168784593) has the molecular formula C14H19FN2O5 and a molecular weight of 314.31 g/mol. Its IUPAC name is tert-butyl N-[4-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 168784593 |
| Molecular Formula | C14H19FN2O5 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | tert-butyl N-[4-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)C1C=C(F)C(=O)NC1=O |
| InChI | InChI=1S/C14H19FN2O5/c1-14(2,3)22-13(21)16-6-4-5-10(18)8-7-9(15)12(20)17-11(8)19/h7-8H,4-6H2,1-3H3,(H,16,21)(H,17,19,20) |
| InChIKey | IZNJWLHTWOPTNK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|