C18H29NO6 — CID 59347325
methyl (1R)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-3-oxocyclopentane-1-carboxylate (PubChem CID 59347325) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is methyl (1R)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-3-oxocyclopentane-1-carboxylate.
| Compound Name | methyl (1R)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-3-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59347325 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | methyl (1R)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-3-oxocyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(=O)C1C(=O)CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO6/c1-18(2,3)25-17(23)19-11-7-5-6-8-13(20)15-12(16(22)24-4)9-10-14(15)21/h12,15H,5-11H2,1-4H3,(H,19,23)/t12-,15?/m1/s1 |
| InChIKey | JTQBTLFRGQIREG-KEKZHRQWSA-N |
| XLogP | 2.41 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|