C13H23NO7 — CID 121483391
tert-butyl N-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]methyl]carbamate (PubChem CID 121483391) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 121483391 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | tert-butyl N-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1[C@H]2OC[C@](CO)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO7/c1-12(2,3)21-11(18)14-4-7-8(16)9(17)13(5-15)6-19-10(7)20-13/h7-10,15-17H,4-6H2,1-3H3,(H,14,18)/t7-,8-,9-,10+,13+/m1/s1 |
| InChIKey | HHBCNCQPQCEZFD-LGMRYKSHSA-N |
| XLogP | -1.03 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |