C11H19BrN2O2 — CID 155006549
tert-butyl N-[(3-bromo-3-azabicyclo[3.1.0]hexan-6-yl)methyl]carbamate (PubChem CID 155006549) has the molecular formula C11H19BrN2O2 and a molecular weight of 291.19 g/mol. Its IUPAC name is tert-butyl N-[(3-bromo-3-azabicyclo[3.1.0]hexan-6-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-bromo-3-azabicyclo[3.1.0]hexan-6-yl)methyl]carbamate |
|---|---|
| PubChem CID | 155006549 |
| Molecular Formula | C11H19BrN2O2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | tert-butyl N-[(3-bromo-3-azabicyclo[3.1.0]hexan-6-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1C2CN(Br)CC12 |
| InChI | InChI=1S/C11H19BrN2O2/c1-11(2,3)16-10(15)13-4-7-8-5-14(12)6-9(7)8/h7-9H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | CGEQJPOUENFTRE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|