C18H32O9 — CID 129015442
2-[2-[2-[2-[[(1S,2R,6R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 129015442) has the molecular formula C18H32O9 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(1S,2R,6R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[[(1S,2R,6R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 129015442 |
| Molecular Formula | C18H32O9 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[2-[2-[2-[[(1S,2R,6R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](C[C@H]3OC[C@]2(COCCOCCOCCOCCO)O3)O1 |
| InChI | InChI=1S/C18H32O9/c1-17(2)25-14-11-15-24-13-18(26-15,16(14)27-17)12-23-10-9-22-8-7-21-6-5-20-4-3-19/h14-16,19H,3-13H2,1-2H3/t14-,15+,16-,18+/m1/s1 |
| InChIKey | HLOQUINCUILICK-HPFXQQBRSA-N |
| XLogP | 0.08 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|