C19H32O8 — CID 129136836
(1S,2R,6R,8S)-4,4-dimethyl-1-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecane (PubChem CID 129136836) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is (1S,2R,6R,8S)-4,4-dimethyl-1-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecane.
| Compound Name | (1S,2R,6R,8S)-4,4-dimethyl-1-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecane |
|---|---|
| PubChem CID | 129136836 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (1S,2R,6R,8S)-4,4-dimethyl-1-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecane |
| SMILES | C=CCOCCOCCOCCOC[C@]12CO[C@H](C[C@H]3OC(C)(C)O[C@H]31)O2 |
| InChI | InChI=1S/C19H32O8/c1-4-5-20-6-7-21-8-9-22-10-11-23-13-19-14-24-16(26-19)12-15-17(19)27-18(2,3)25-15/h4,15-17H,1,5-14H2,2-3H3/t15-,16+,17-,19+/m1/s1 |
| InChIKey | VVYNPHHIJWVRHJ-NTDBWNAOSA-N |
| XLogP | 1.27 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|