C18H30O9 — CID 123985078
2-[2-[2-[2-[(4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl)methoxy]ethoxy]ethoxy]ethoxy]acetaldehyde (PubChem CID 123985078) has the molecular formula C18H30O9 and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-[2-[2-[2-[(4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl)methoxy]ethoxy]ethoxy]ethoxy]acetaldehyde.
| Compound Name | 2-[2-[2-[2-[(4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl)methoxy]ethoxy]ethoxy]ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 123985078 |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[2-[2-[2-[(4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl)methoxy]ethoxy]ethoxy]ethoxy]acetaldehyde |
| SMILES | CC1(C)OC2CC3OCC(COCCOCCOCCOCC=O)(O3)C2O1 |
| InChI | InChI=1S/C18H30O9/c1-17(2)25-14-11-15-24-13-18(26-15,16(14)27-17)12-23-10-9-22-8-7-21-6-5-20-4-3-19/h3,14-16H,4-13H2,1-2H3 |
| InChIKey | MRRXLSFATRFQJT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|