C19H34O8 — CID 129015256
[(3aR,4R,7aR)-2,2-dimethyl-4-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol (PubChem CID 129015256) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is [(3aR,4R,7aR)-2,2-dimethyl-4-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol.
| Compound Name | [(3aR,4R,7aR)-2,2-dimethyl-4-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol |
|---|---|
| PubChem CID | 129015256 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [(3aR,4R,7aR)-2,2-dimethyl-4-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxymethyl]-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol |
| SMILES | C=CCOCCOCCOCCOC[C@@]1(CO)OCC[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C19H34O8/c1-4-6-21-8-9-22-10-11-23-12-13-24-15-19(14-20)17-16(5-7-25-19)26-18(2,3)27-17/h4,16-17,20H,1,5-15H2,2-3H3/t16-,17-,19-/m1/s1 |
| InChIKey | PQFRRJKTZAVCQK-ZHALLVOQSA-N |
| XLogP | 0.91 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|