C18H35NO7 — CID 167221514
2-[2-[2-[2-[[(3aR,4R,7aR)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 167221514) has the molecular formula C18H35NO7 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(3aR,4R,7aR)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[2-[[(3aR,4R,7aR)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 167221514 |
| Molecular Formula | C18H35NO7 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 2-[2-[2-[2-[[(3aR,4R,7aR)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CCO[C@]2(C)COCCOCCOCCOCCN)O1 |
| InChI | InChI=1S/C18H35NO7/c1-17(2)25-15-4-6-24-18(3,16(15)26-17)14-23-13-12-22-11-10-21-9-8-20-7-5-19/h15-16H,4-14,19H2,1-3H3/t15-,16-,18-/m1/s1 |
| InChIKey | ORHYIWLSXCULJM-JFIYKMOQSA-N |
| XLogP | 0.71 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|