C13H26O6 — CID 86174948
2-[2-[2-[(5-ethyl-1,3-dioxan-5-yl)methoxy]ethoxy]ethoxy]ethanol (PubChem CID 86174948) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[2-[2-[(5-ethyl-1,3-dioxan-5-yl)methoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[(5-ethyl-1,3-dioxan-5-yl)methoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 86174948 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[2-[2-[(5-ethyl-1,3-dioxan-5-yl)methoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCC1(COCCOCCOCCO)COCOC1 |
| InChI | InChI=1S/C13H26O6/c1-2-13(10-18-12-19-11-13)9-17-8-7-16-6-5-15-4-3-14/h14H,2-12H2,1H3 |
| InChIKey | IJKLWJXTOJJEJA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|