C19H33NO8 — CID 25209605
tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)pent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 25209605) has the molecular formula C19H33NO8 and a molecular weight of 403.47 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)pent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)pent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 25209605 |
| Molecular Formula | C19H33NO8 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)pent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C#C[C@@H](O)[C@H](OCOC)[C@@H](OCOC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO8/c1-9-14(21)16(26-12-24-8)15(25-11-23-7)13-10-27-19(5,6)20(13)17(22)28-18(2,3)4/h1,13-16,21H,10-12H2,2-8H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | FWQWTDBYQNBGPZ-FZKCQIBNSA-N |
| XLogP | 1.33 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|