C17H31NO7 — CID 56963828
tert-butyl (4S)-4-[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 56963828) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 56963828 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl (4S)-4-[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H]2OC(C)(C)O[C@@H]2[C@H](O)CO)COC1(C)C |
| InChI | InChI=1S/C17H31NO7/c1-15(2,3)25-14(21)18-10(9-22-16(18,4)5)12-13(11(20)8-19)24-17(6,7)23-12/h10-13,19-20H,8-9H2,1-7H3/t10-,11+,12-,13+/m0/s1 |
| InChIKey | GMXKQFYGATVHSP-QNWHQSFQSA-N |
| XLogP | 1.23 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |