C18H33NO9 — CID 135012309
tert-butyl N-[(2S,3S,4S,5S)-1-hydroxy-3,4,5-tris(methoxymethoxy)hept-6-yn-2-yl]carbamate (PubChem CID 135012309) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4S,5S)-1-hydroxy-3,4,5-tris(methoxymethoxy)hept-6-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4S,5S)-1-hydroxy-3,4,5-tris(methoxymethoxy)hept-6-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 135012309 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl N-[(2S,3S,4S,5S)-1-hydroxy-3,4,5-tris(methoxymethoxy)hept-6-yn-2-yl]carbamate |
| SMILES | C#C[C@H](OCOC)[C@H](OCOC)[C@@H](OCOC)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO9/c1-8-14(25-10-22-5)16(27-12-24-7)15(26-11-23-6)13(9-20)19-17(21)28-18(2,3)4/h1,13-16,20H,9-12H2,2-7H3,(H,19,21)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | GWVRSEIOWAHJSE-VGWMRTNUSA-N |
| XLogP | 0.47 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|