C16H33NO6 — CID 10860639
tert-butyl N-[(4S,5S)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate (PubChem CID 10860639) has the molecular formula C16H33NO6 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate |
|---|---|
| PubChem CID | 10860639 |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl N-[(4S,5S)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate |
| SMILES | CC[C@H](OCOCCOC)[C@H](CCCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H33NO6/c1-6-14(22-12-21-11-10-20-5)13(8-7-9-18)17-15(19)23-16(2,3)4/h13-14,18H,6-12H2,1-5H3,(H,17,19)/t13-,14-/m0/s1 |
| InChIKey | VHRPJKNQNWRBSD-KBPBESRZSA-N |
| XLogP | 2.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|