C22H41NO8Si — CID 25209604
tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)-5-trimethylsilylpent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 25209604) has the molecular formula C22H41NO8Si and a molecular weight of 475.66 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)-5-trimethylsilylpent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)-5-trimethylsilylpent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 25209604 |
| Molecular Formula | C22H41NO8Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,2S,3R)-3-hydroxy-1,2-bis(methoxymethoxy)-5-trimethylsilylpent-4-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COCO[C@H]([C@@H](OCOC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H41NO8Si/c1-21(2,3)31-20(25)23-16(13-30-22(23,4)5)18(28-14-26-6)19(29-15-27-7)17(24)11-12-32(8,9)10/h16-19,24H,13-15H2,1-10H3/t16-,17+,18-,19-/m0/s1 |
| InChIKey | ZGHXMWXIWDVILV-RDGPPVDQSA-N |
| XLogP | 2.58 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|