C30H61NO10Si — CID 57385688
tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-tris(ethoxymethoxy)pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57385688) has the molecular formula C30H61NO10Si and a molecular weight of 623.90 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-tris(ethoxymethoxy)pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-tris(ethoxymethoxy)pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57385688 |
| Molecular Formula | C30H61NO10Si |
| Molecular Weight | 623.90 g/mol |
| Exact Mass | 623.41 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-tris(ethoxymethoxy)pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOCO[C@H]([C@@H](OCOCC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)[C@@H](CCO[Si](C)(C)C(C)(C)C)OCOCC |
| InChI | InChI=1S/C30H61NO10Si/c1-14-33-20-36-24(17-18-40-42(12,13)29(7,8)9)26(38-22-35-16-3)25(37-21-34-15-2)23-19-39-30(10,11)31(23)27(32)41-28(4,5)6/h23-26H,14-22H2,1-13H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | RXEMJLANYVQDNF-QYOOZWMWSA-N |
| XLogP | 5.91 |
| TPSA | 103.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.90 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|