C29H59NO7Si2 — CID 56963827
tert-butyl (4S)-4-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 56963827) has the molecular formula C29H59NO7Si2 and a molecular weight of 589.96 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 56963827 |
| Molecular Formula | C29H59NO7Si2 |
| Molecular Weight | 589.96 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | tert-butyl (4S)-4-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H]2OC(C)(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C29H59NO7Si2/c1-25(2,3)36-24(31)30-20(18-32-28(30,10)11)22-23(35-29(12,13)34-22)21(37-39(16,17)27(7,8)9)19-33-38(14,15)26(4,5)6/h20-23H,18-19H2,1-17H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | XOZDUHLAMPEXQX-GSPCLOLRSA-N |
| XLogP | 7.29 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.96 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|