C21H37NO9 — CID 135012251
tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S,3S)-1,2,3-tris(methoxymethoxy)pent-4-ynyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 135012251) has the molecular formula C21H37NO9 and a molecular weight of 447.53 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S,3S)-1,2,3-tris(methoxymethoxy)pent-4-ynyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S,3S)-1,2,3-tris(methoxymethoxy)pent-4-ynyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135012251 |
| Molecular Formula | C21H37NO9 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S,3S)-1,2,3-tris(methoxymethoxy)pent-4-ynyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C#C[C@H](OCOC)[C@H](OCOC)[C@@H](OCOC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO9/c1-10-16(27-12-24-7)18(29-14-26-9)17(28-13-25-8)15-11-30-21(5,6)22(15)19(23)31-20(2,3)4/h1,15-18H,11-14H2,2-9H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | DYOVWXHITOBHFQ-XSLAGTTESA-N |
| XLogP | 1.96 |
| TPSA | 94.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|