C21H39NO8Si — CID 71817284
tert-butyl (3aS,5S,6R,6aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-3a-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 71817284) has the molecular formula C21H39NO8Si and a molecular weight of 461.63 g/mol. Its IUPAC name is tert-butyl (3aS,5S,6R,6aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-3a-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,5S,6R,6aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-3a-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 71817284 |
| Molecular Formula | C21H39NO8Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | tert-butyl (3aS,5S,6R,6aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-3a-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC=O)[C@@H]2OC(C)(C)O[C@@]21CO |
| InChI | InChI=1S/C21H39NO8Si/c1-18(2,3)29-17(25)22-14(11-27-31(9,10)19(4,5)6)15(26-13-24)16-21(22,12-23)30-20(7,8)28-16/h13-16,23H,11-12H2,1-10H3/t14-,15+,16-,21-/m0/s1 |
| InChIKey | NICFMOXNTGMIEN-YJXLLHPSSA-N |
| XLogP | 3.01 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|