C18H33NO9 — CID 134880949
tert-butyl (4R)-4-[(2S,4R,5R,6S)-4-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134880949) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(2S,4R,5R,6S)-4-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(2S,4R,5R,6S)-4-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134880949 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl (4R)-4-[(2S,4R,5R,6S)-4-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CO[C@H]1O[C@H]([C@H]2COC(C)(C)N2C(=O)OC(C)(C)C)C[C@@](O)([C@@H](O)CO)[C@H]1O |
| InChI | InChI=1S/C18H33NO9/c1-16(2,3)28-15(23)19-10(9-26-17(19,4)5)11-7-18(24,12(21)8-20)13(22)14(25-6)27-11/h10-14,20-22,24H,7-9H2,1-6H3/t10-,11+,12+,13+,14+,18-/m1/s1 |
| InChIKey | LPVSXBIYRIWQIN-NWABDCGUSA-N |
| XLogP | -0.44 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |