C30H63NO9Si2 — CID 11802227
tert-butyl (4S,5S)-4-[(1R,2S,3S,4S,5S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6-tetrahydroxyheptyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11802227) has the molecular formula C30H63NO9Si2 and a molecular weight of 638.00 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[(1R,2S,3S,4S,5S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6-tetrahydroxyheptyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[(1R,2S,3S,4S,5S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6-tetrahydroxyheptyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11802227 |
| Molecular Formula | C30H63NO9Si2 |
| Molecular Weight | 638.00 g/mol |
| Exact Mass | 637.40 |
| IUPAC Name | tert-butyl (4S,5S)-4-[(1R,2S,3S,4S,5S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6-tetrahydroxyheptyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C30H63NO9Si2/c1-18(32)21(33)24(39-41(14,15)28(6,7)8)25(40-42(16,17)29(9,10)11)23(35)22(34)20-19(2)37-30(12,13)31(20)26(36)38-27(3,4)5/h18-25,32-35H,1-17H3/t18-,19+,20-,21+,22-,23+,24+,25+/m1/s1 |
| InChIKey | OKUKUQJSESRMDF-IHWIZGRESA-N |
| XLogP | 4.99 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|