C23H18F3N5O2 — CID 25113649
N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(1-pyridin-3-yltriazol-4-yl)benzamide (PubChem CID 25113649) has the molecular formula C23H18F3N5O2 and a molecular weight of 453.42 g/mol. Its IUPAC name is N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(1-pyridin-3-yltriazol-4-yl)benzamide.
| Compound Name | N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(1-pyridin-3-yltriazol-4-yl)benzamide |
|---|---|
| PubChem CID | 25113649 |
| Molecular Formula | C23H18F3N5O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(1-pyridin-3-yltriazol-4-yl)benzamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)c1ccc(C)c(-c2cn(-c3cccnc3)nn2)c1 |
| InChI | InChI=1S/C23H18F3N5O2/c1-14-5-6-15(10-18(14)20-13-31(30-29-20)17-4-3-9-27-12-17)22(32)28-19-11-16(23(24,25)26)7-8-21(19)33-2/h3-13H,1-2H3,(H,28,32) |
| InChIKey | XWHFOSMVZYPAMB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |