C22H16N4S — CID 25114984
4-[(4-methyl-6-naphthalen-2-ylsulfanylpyrimidin-2-yl)amino]benzonitrile (PubChem CID 25114984) has the molecular formula C22H16N4S and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-[(4-methyl-6-naphthalen-2-ylsulfanylpyrimidin-2-yl)amino]benzonitrile.
| Compound Name | 4-[(4-methyl-6-naphthalen-2-ylsulfanylpyrimidin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 25114984 |
| Molecular Formula | C22H16N4S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4-[(4-methyl-6-naphthalen-2-ylsulfanylpyrimidin-2-yl)amino]benzonitrile |
| SMILES | Cc1cc(Sc2ccc3ccccc3c2)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C22H16N4S/c1-15-12-21(27-20-11-8-17-4-2-3-5-18(17)13-20)26-22(24-15)25-19-9-6-16(14-23)7-10-19/h2-13H,1H3,(H,24,25,26) |
| InChIKey | QFYLJYPNHZSNJB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |