C24H17Cl3N4O2 — CID 25115897
[(E)-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methylideneamino] N-phenylcarbamate (PubChem CID 25115897) has the molecular formula C24H17Cl3N4O2 and a molecular weight of 499.79 g/mol. Its IUPAC name is [(E)-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methylideneamino] N-phenylcarbamate.
| Compound Name | [(E)-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methylideneamino] N-phenylcarbamate |
|---|---|
| PubChem CID | 25115897 |
| Molecular Formula | C24H17Cl3N4O2 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | [(E)-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methylideneamino] N-phenylcarbamate |
| SMILES | Cc1c(/C=N/OC(=O)Nc2ccccc2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N4O2/c1-15-21(14-28-33-24(32)29-19-5-3-2-4-6-19)30-31(22-12-11-18(26)13-20(22)27)23(15)16-7-9-17(25)10-8-16/h2-14H,1H3,(H,29,32)/b28-14+ |
| InChIKey | IPAOIMDTGGZGNT-CCVNUDIWSA-N |
| XLogP | 7.39 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|