C26H21FN6O4 — CID 25116379
N-[4-[2-(4-fluoro-3-methylphenyl)-6,8-dimethoxyimidazo[1,2-b]pyridazin-3-yl]-2-pyridinyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 25116379) has the molecular formula C26H21FN6O4 and a molecular weight of 500.49 g/mol. Its IUPAC name is N-[4-[2-(4-fluoro-3-methylphenyl)-6,8-dimethoxyimidazo[1,2-b]pyridazin-3-yl]-2-pyridinyl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[4-[2-(4-fluoro-3-methylphenyl)-6,8-dimethoxyimidazo[1,2-b]pyridazin-3-yl]-2-pyridinyl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 25116379 |
| Molecular Formula | C26H21FN6O4 |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[4-[2-(4-fluoro-3-methylphenyl)-6,8-dimethoxyimidazo[1,2-b]pyridazin-3-yl]-2-pyridinyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | COc1cc(OC)c2nc(-c3ccc(F)c(C)c3)c(-c3ccnc(NC(=O)c4ccc[n+]([O-])c4)c3)n2n1 |
| InChI | InChI=1S/C26H21FN6O4/c1-15-11-16(6-7-19(15)27)23-24(33-25(30-23)20(36-2)13-22(31-33)37-3)17-8-9-28-21(12-17)29-26(34)18-5-4-10-32(35)14-18/h4-14H,1-3H3,(H,28,29,34) |
| InChIKey | GKEDZMWEVXPNFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|