C19H25N5O2 — CID 25119154
5-(4-amino-2-methoxyphenyl)-1-cyclohexyl-3-methyl-6,7a-dihydro-3aH-pyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 25119154) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-(4-amino-2-methoxyphenyl)-1-cyclohexyl-3-methyl-6,7a-dihydro-3aH-pyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | 5-(4-amino-2-methoxyphenyl)-1-cyclohexyl-3-methyl-6,7a-dihydro-3aH-pyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 25119154 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 5-(4-amino-2-methoxyphenyl)-1-cyclohexyl-3-methyl-6,7a-dihydro-3aH-pyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | COc1cc(N)ccc1C1=NC2C(C)=NN(C3CCCCC3)C2C(=O)N1 |
| InChI | InChI=1S/C19H25N5O2/c1-11-16-17(24(23-11)13-6-4-3-5-7-13)19(25)22-18(21-16)14-9-8-12(20)10-15(14)26-2/h8-10,13,16-17H,3-7,20H2,1-2H3,(H,21,22,25) |
| InChIKey | GGHNTXBVTQIVRN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|