C20H18Cl2N2O3 — CID 25119442
1'-[2-(2,3-dichlorophenoxy)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 25119442) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is 1'-[2-(2,3-dichlorophenoxy)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-[2-(2,3-dichlorophenoxy)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 25119442 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1'-[2-(2,3-dichlorophenoxy)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C(COc1cccc(Cl)c1Cl)N1CCC2(CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C20H18Cl2N2O3/c21-14-5-3-7-16(18(14)22)27-12-17(25)24-10-8-20(9-11-24)13-4-1-2-6-15(13)23-19(20)26/h1-7H,8-12H2,(H,23,26) |
| InChIKey | KBHUOGPJHSIRQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |