C14H19N2O7P — CID 25121232
[2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]oxymethylphosphonic acid (PubChem CID 25121232) has the molecular formula C14H19N2O7P and a molecular weight of 358.29 g/mol. Its IUPAC name is [2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]oxymethylphosphonic acid.
| Compound Name | [2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 25121232 |
| Molecular Formula | C14H19N2O7P |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]oxymethylphosphonic acid |
| SMILES | Cc1cn(C2C3CC4C(COC42)C3OCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19N2O7P/c1-6-3-16(14(18)15-13(6)17)10-8-2-7-9(4-22-12(7)10)11(8)23-5-24(19,20)21/h3,7-12H,2,4-5H2,1H3,(H,15,17,18)(H2,19,20,21) |
| InChIKey | QUYLMVISADWVBB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|